C22H29N5O — CID 51934536
(3S)-N-(1-benzylpiperidin-4-yl)-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 51934536) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is (3S)-N-(1-benzylpiperidin-4-yl)-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(1-benzylpiperidin-4-yl)-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51934536 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (3S)-N-(1-benzylpiperidin-4-yl)-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)[C@H]1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C22H29N5O/c28-22(19-7-4-12-27(17-19)21-15-23-10-11-24-21)25-20-8-13-26(14-9-20)16-18-5-2-1-3-6-18/h1-3,5-6,10-11,15,19-20H,4,7-9,12-14,16-17H2,(H,25,28)/t19-/m0/s1 |
| InChIKey | VICCOAZGSXMTFB-IBGZPJMESA-N |
| XLogP | 2.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |