C21H34N4O — CID 46597405
N-[4-(2-methylbutan-2-yl)cyclohexyl]-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 46597405) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[4-(2-methylbutan-2-yl)cyclohexyl]-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[4-(2-methylbutan-2-yl)cyclohexyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46597405 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | N-[4-(2-methylbutan-2-yl)cyclohexyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)C2CCCN(c3cnccn3)C2)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-4-21(2,3)17-7-9-18(10-8-17)24-20(26)16-6-5-13-25(15-16)19-14-22-11-12-23-19/h11-12,14,16-18H,4-10,13,15H2,1-3H3,(H,24,26) |
| InChIKey | LREVPHIAHSKGGW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |