C13H19N5O3 — CID 37002369
ethyl N-[[(3R)-1-pyrazin-2-ylpiperidine-3-carbonyl]amino]carbamate (PubChem CID 37002369) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is ethyl N-[[(3R)-1-pyrazin-2-ylpiperidine-3-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[(3R)-1-pyrazin-2-ylpiperidine-3-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 37002369 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | ethyl N-[[(3R)-1-pyrazin-2-ylpiperidine-3-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)[C@@H]1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C13H19N5O3/c1-2-21-13(20)17-16-12(19)10-4-3-7-18(9-10)11-8-14-5-6-15-11/h5-6,8,10H,2-4,7,9H2,1H3,(H,16,19)(H,17,20)/t10-/m1/s1 |
| InChIKey | WGFHFTLGWVLHGF-SNVBAGLBSA-N |
| XLogP | 0.47 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|