C16H16Cl3N5O — CID 51113453
1-pyrazin-2-yl-N'-(2,4,6-trichlorophenyl)piperidine-3-carbohydrazide (PubChem CID 51113453) has the molecular formula C16H16Cl3N5O and a molecular weight of 400.70 g/mol. Its IUPAC name is 1-pyrazin-2-yl-N'-(2,4,6-trichlorophenyl)piperidine-3-carbohydrazide.
| Compound Name | 1-pyrazin-2-yl-N'-(2,4,6-trichlorophenyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 51113453 |
| Molecular Formula | C16H16Cl3N5O |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 1-pyrazin-2-yl-N'-(2,4,6-trichlorophenyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNc1c(Cl)cc(Cl)cc1Cl)C1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C16H16Cl3N5O/c17-11-6-12(18)15(13(19)7-11)22-23-16(25)10-2-1-5-24(9-10)14-8-20-3-4-21-14/h3-4,6-8,10,22H,1-2,5,9H2,(H,23,25) |
| InChIKey | VYGKMHQOUSPKPQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|