C14H20N4O3S — CID 37037897
(3S)-N-[(3R)-1,1-dioxothiolan-3-yl]-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 37037897) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is (3S)-N-[(3R)-1,1-dioxothiolan-3-yl]-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(3R)-1,1-dioxothiolan-3-yl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 37037897 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (3S)-N-[(3R)-1,1-dioxothiolan-3-yl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)[C@H]1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C14H20N4O3S/c19-14(17-12-3-7-22(20,21)10-12)11-2-1-6-18(9-11)13-8-15-4-5-16-13/h4-5,8,11-12H,1-3,6-7,9-10H2,(H,17,19)/t11-,12+/m0/s1 |
| InChIKey | PGJBZCLSQVWQEH-NWDGAFQWSA-N |
| XLogP | -0.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |