C18H28N4O — CID 47024943
N-(2,3-dimethylcyclohexyl)-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 47024943) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 47024943 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | CC1CCCC(NC(=O)C2CCCN(c3cnccn3)C2)C1C |
| InChI | InChI=1S/C18H28N4O/c1-13-5-3-7-16(14(13)2)21-18(23)15-6-4-10-22(12-15)17-11-19-8-9-20-17/h8-9,11,13-16H,3-7,10,12H2,1-2H3,(H,21,23) |
| InChIKey | STLHQXKOWRWKGX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |