C18H28N4O — CID 94824323
(3S)-N-(1-ethylpiperidin-4-yl)-1-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 94824323) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (3S)-N-(1-ethylpiperidin-4-yl)-1-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(1-ethylpiperidin-4-yl)-1-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94824323 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (3S)-N-(1-ethylpiperidin-4-yl)-1-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | CCN1CCC(NC(=O)[C@H]2CCCN(c3ccccn3)C2)CC1 |
| InChI | InChI=1S/C18H28N4O/c1-2-21-12-8-16(9-13-21)20-18(23)15-6-5-11-22(14-15)17-7-3-4-10-19-17/h3-4,7,10,15-16H,2,5-6,8-9,11-14H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | CYLGVZGRHNCVJU-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |