C23H27F2N3O2 — CID 175643881
N-[4-(3,5-difluorophenoxy)cyclohexyl]-1-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 175643881) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[4-(3,5-difluorophenoxy)cyclohexyl]-1-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[4-(3,5-difluorophenoxy)cyclohexyl]-1-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 175643881 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[4-(3,5-difluorophenoxy)cyclohexyl]-1-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCC(Oc2cc(F)cc(F)c2)CC1)C1CCCN(c2ccccn2)C1 |
| InChI | InChI=1S/C23H27F2N3O2/c24-17-12-18(25)14-21(13-17)30-20-8-6-19(7-9-20)27-23(29)16-4-3-11-28(15-16)22-5-1-2-10-26-22/h1-2,5,10,12-14,16,19-20H,3-4,6-9,11,15H2,(H,27,29) |
| InChIKey | ZLXPDIDDUIDHHU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |