C19H23N3O — CID 51962224
(3R)-N-(3,5-dimethylphenyl)-1-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 51962224) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (3R)-N-(3,5-dimethylphenyl)-1-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(3,5-dimethylphenyl)-1-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51962224 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (3R)-N-(3,5-dimethylphenyl)-1-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@H]2CCCN(c3ccccn3)C2)c1 |
| InChI | InChI=1S/C19H23N3O/c1-14-10-15(2)12-17(11-14)21-19(23)16-6-5-9-22(13-16)18-7-3-4-8-20-18/h3-4,7-8,10-12,16H,5-6,9,13H2,1-2H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | KYPNSWLWCKHQSC-MRXNPFEDSA-N |
| XLogP | 3.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |