C23H28N4O4 — CID 126465966
methyl 3-(propanoylamino)-5-[[(1-pyridin-2-ylpiperidine-3-carbonyl)amino]methyl]benzoate (PubChem CID 126465966) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 3-(propanoylamino)-5-[[(1-pyridin-2-ylpiperidine-3-carbonyl)amino]methyl]benzoate.
| Compound Name | methyl 3-(propanoylamino)-5-[[(1-pyridin-2-ylpiperidine-3-carbonyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 126465966 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | methyl 3-(propanoylamino)-5-[[(1-pyridin-2-ylpiperidine-3-carbonyl)amino]methyl]benzoate |
| SMILES | CCC(=O)Nc1cc(CNC(=O)C2CCCN(c3ccccn3)C2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-3-21(28)26-19-12-16(11-18(13-19)23(30)31-2)14-25-22(29)17-7-6-10-27(15-17)20-8-4-5-9-24-20/h4-5,8-9,11-13,17H,3,6-7,10,14-15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | KMCAAUCDASJWGM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |