C23H28FN3O2 — CID 58585901
(3S)-1-[5-(2-fluorophenyl)-2-pyridinyl]-N-(4-hydroxycyclohexyl)piperidine-3-carboxamide (PubChem CID 58585901) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is (3S)-1-[5-(2-fluorophenyl)-2-pyridinyl]-N-(4-hydroxycyclohexyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[5-(2-fluorophenyl)-2-pyridinyl]-N-(4-hydroxycyclohexyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 58585901 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (3S)-1-[5-(2-fluorophenyl)-2-pyridinyl]-N-(4-hydroxycyclohexyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)[C@H]1CCCN(c2ccc(-c3ccccc3F)cn2)C1 |
| InChI | InChI=1S/C23H28FN3O2/c24-21-6-2-1-5-20(21)16-7-12-22(25-14-16)27-13-3-4-17(15-27)23(29)26-18-8-10-19(28)11-9-18/h1-2,5-7,12,14,17-19,28H,3-4,8-11,13,15H2,(H,26,29)/t17-,18?,19?/m0/s1 |
| InChIKey | FNGJQELOORQCPJ-VIQWUECVSA-N |
| XLogP | 3.52 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |