C20H24N4O — CID 93055724
(3S)-N-cyclopropyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 93055724) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (3S)-N-cyclopropyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-cyclopropyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93055724 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3S)-N-cyclopropyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc(N3CCC[C@H](C(=O)NC4CC4)C3)nn2)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-14-4-6-15(7-5-14)18-10-11-19(23-22-18)24-12-2-3-16(13-24)20(25)21-17-8-9-17/h4-7,10-11,16-17H,2-3,8-9,12-13H2,1H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | YJYOEPKEWWGXRE-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |