C22H28N4OS — CID 92866952
(3S)-N-cyclopentyl-1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 92866952) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92866952 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(Sc2ccc(N3CCC[C@H](C(=O)NC4CCCC4)C3)nn2)cc1 |
| InChI | InChI=1S/C22H28N4OS/c1-16-8-10-19(11-9-16)28-21-13-12-20(24-25-21)26-14-4-5-17(15-26)22(27)23-18-6-2-3-7-18/h8-13,17-18H,2-7,14-15H2,1H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | CNOOJBQAJBXKIK-KRWDZBQOSA-N |
| XLogP | 4.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |