C22H28N4O — CID 93055740
(3S)-N-cyclopentyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 93055740) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93055740 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (3S)-N-cyclopentyl-1-[6-(4-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc(N3CCC[C@H](C(=O)NC4CCCC4)C3)nn2)cc1 |
| InChI | InChI=1S/C22H28N4O/c1-16-8-10-17(11-9-16)20-12-13-21(25-24-20)26-14-4-5-18(15-26)22(27)23-19-6-2-3-7-19/h8-13,18-19H,2-7,14-15H2,1H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | SSCAVQNBYSKVCE-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |