C27H26N4OS — CID 46507687
1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide (PubChem CID 46507687) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46507687 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-[6-(4-methylphenyl)sulfanylpyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(Sc2ccc(N3CCCC(C(=O)Nc4cccc5ccccc45)C3)nn2)cc1 |
| InChI | InChI=1S/C27H26N4OS/c1-19-11-13-22(14-12-19)33-26-16-15-25(29-30-26)31-17-5-8-21(18-31)27(32)28-24-10-4-7-20-6-2-3-9-23(20)24/h2-4,6-7,9-16,21H,5,8,17-18H2,1H3,(H,28,32) |
| InChIKey | LFEWZWRQPAQLOM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |