C24H26N4OS — CID 50768566
N-[(4-methylphenyl)methyl]-1-(6-phenylsulfanylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 50768566) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-1-(6-phenylsulfanylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]-1-(6-phenylsulfanylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50768566 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-1-(6-phenylsulfanylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(c3ccc(Sc4ccccc4)nn3)CC2)cc1 |
| InChI | InChI=1S/C24H26N4OS/c1-18-7-9-19(10-8-18)17-25-24(29)20-13-15-28(16-14-20)22-11-12-23(27-26-22)30-21-5-3-2-4-6-21/h2-12,20H,13-17H2,1H3,(H,25,29) |
| InChIKey | ZWTLUPOSKZMUOX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |