C20H25ClN4O2S — CID 50768489
1-[6-(4-chlorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 50768489) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[6-(4-chlorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50768489 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[6-(4-chlorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(c2ccc(Sc3ccc(Cl)cc3)nn2)CC1 |
| InChI | InChI=1S/C20H25ClN4O2S/c1-27-14-2-11-22-20(26)15-9-12-25(13-10-15)18-7-8-19(24-23-18)28-17-5-3-16(21)4-6-17/h3-8,15H,2,9-14H2,1H3,(H,22,26) |
| InChIKey | PBDRYSARKYCJOA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|