C20H25FN4O2S — CID 50768462
1-[6-(3-fluorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 50768462) has the molecular formula C20H25FN4O2S and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[6-(3-fluorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[6-(3-fluorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50768462 |
| Molecular Formula | C20H25FN4O2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[6-(3-fluorophenyl)sulfanylpyridazin-3-yl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(c2ccc(Sc3cccc(F)c3)nn2)CC1 |
| InChI | InChI=1S/C20H25FN4O2S/c1-27-13-3-10-22-20(26)15-8-11-25(12-9-15)18-6-7-19(24-23-18)28-17-5-2-4-16(21)14-17/h2,4-7,14-15H,3,8-13H2,1H3,(H,22,26) |
| InChIKey | TVNSURITRJEBBO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|