C20H25FN4O3 — CID 53071163
1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)piperidine-3-carboxamide (PubChem CID 53071163) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53071163 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-methoxypropyl)piperidine-3-carboxamide |
| SMILES | COCCCNC(=O)C1CCCN(c2ccc(=O)n(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C20H25FN4O3/c1-28-12-4-10-22-20(27)15-5-3-11-24(14-15)18-8-9-19(26)25(23-18)17-7-2-6-16(21)13-17/h2,6-9,13,15H,3-5,10-12,14H2,1H3,(H,22,27) |
| InChIKey | YUVKVUPVHVYVSH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|