C25H27FN4O2 — CID 95069446
(3S)-1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 95069446) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is (3S)-1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95069446 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3S)-1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@H]1CCCN(c2ccc(=O)n(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C25H27FN4O2/c26-21-11-4-12-22(17-21)30-24(31)14-13-23(28-30)29-16-6-10-20(18-29)25(32)27-15-5-9-19-7-2-1-3-8-19/h1-4,7-8,11-14,17,20H,5-6,9-10,15-16,18H2,(H,27,32)/t20-/m0/s1 |
| InChIKey | SBNXRFJTMBGPPW-FQEVSTJZSA-N |
| XLogP | 3.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|