C25H28N4O2S — CID 50768357
1-(6-benzylsulfanylpyridazin-3-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 50768357) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-(6-benzylsulfanylpyridazin-3-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(6-benzylsulfanylpyridazin-3-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50768357 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-(6-benzylsulfanylpyridazin-3-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)C2CCN(c3ccc(SCc4ccccc4)nn3)CC2)c1 |
| InChI | InChI=1S/C25H28N4O2S/c1-31-22-9-5-8-20(16-22)17-26-25(30)21-12-14-29(15-13-21)23-10-11-24(28-27-23)32-18-19-6-3-2-4-7-19/h2-11,16,21H,12-15,17-18H2,1H3,(H,26,30) |
| InChIKey | SHPJUGKQYUUSKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |