C29H30N4O3 — CID 30444897
1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 30444897) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30444897 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)C2CCN(c3nc4ccccc4n(Cc4ccccc4)c3=O)CC2)c1 |
| InChI | InChI=1S/C29H30N4O3/c1-36-24-11-7-10-22(18-24)19-30-28(34)23-14-16-32(17-15-23)27-29(35)33(20-21-8-3-2-4-9-21)26-13-6-5-12-25(26)31-27/h2-13,18,23H,14-17,19-20H2,1H3,(H,30,34) |
| InChIKey | GPHQXOGGAYWPBE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |