C28H27FN4O2 — CID 95068930
(3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 95068930) has the molecular formula C28H27FN4O2 and a molecular weight of 470.55 g/mol. Its IUPAC name is (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95068930 |
| Molecular Formula | C28H27FN4O2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)[C@H]1CCCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)C1 |
| InChI | InChI=1S/C28H27FN4O2/c29-23-12-6-10-21(16-23)17-30-27(34)22-11-7-15-32(19-22)26-28(35)33(18-20-8-2-1-3-9-20)25-14-5-4-13-24(25)31-26/h1-6,8-10,12-14,16,22H,7,11,15,17-19H2,(H,30,34)/t22-/m0/s1 |
| InChIKey | LXJJJNBBWOVKGO-QFIPXVFZSA-N |
| XLogP | 4.12 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |