C28H37N5O2 — CID 53070172
1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide (PubChem CID 53070172) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53070172 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[3-(diethylamino)propyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)C1 |
| InChI | InChI=1S/C28H37N5O2/c1-3-31(4-2)18-11-17-29-27(34)23-14-10-19-32(21-23)26-28(35)33(20-22-12-6-5-7-13-22)25-16-9-8-15-24(25)30-26/h5-9,12-13,15-16,23H,3-4,10-11,14,17-21H2,1-2H3,(H,29,34) |
| InChIKey | KFAOZGQNESBFFS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|