C27H34N4O3 — CID 53070354
N-(3-ethoxypropyl)-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide (PubChem CID 53070354) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53070354 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCCN(c2nc3ccccc3n(Cc3ccc(C)cc3)c2=O)C1 |
| InChI | InChI=1S/C27H34N4O3/c1-3-34-17-7-15-28-26(32)22-8-6-16-30(19-22)25-27(33)31(18-21-13-11-20(2)12-14-21)24-10-5-4-9-23(24)29-25/h4-5,9-14,22H,3,6-8,15-19H2,1-2H3,(H,28,32) |
| InChIKey | QKBIWJIFRVAECF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|