C30H36N4O2 — CID 30457551
(3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide (PubChem CID 30457551) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30457551 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (3S)-N-[2-(cyclohexen-1-yl)ethyl]-1-[4-[(4-methylphenyl)methyl]-3-oxoquinoxalin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)c(N3CCC[C@H](C(=O)NCCC4=CCCCC4)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H36N4O2/c1-22-13-15-24(16-14-22)20-34-27-12-6-5-11-26(27)32-28(30(34)36)33-19-7-10-25(21-33)29(35)31-18-17-23-8-3-2-4-9-23/h5-6,8,11-16,25H,2-4,7,9-10,17-21H2,1H3,(H,31,35)/t25-/m0/s1 |
| InChIKey | IBYJOOKVWUBFDD-VWLOTQADSA-N |
| XLogP | 4.98 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|