C27H36FN5O — CID 20882877
N-[3-(diethylamino)propyl]-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide (PubChem CID 20882877) has the molecular formula C27H36FN5O and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20882877 |
| Molecular Formula | C27H36FN5O |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(c2nc3ccccc3n2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H36FN5O/c1-3-31(4-2)17-7-16-29-26(34)22-14-18-32(19-15-22)27-30-24-8-5-6-9-25(24)33(27)20-21-10-12-23(28)13-11-21/h5-6,8-13,22H,3-4,7,14-20H2,1-2H3,(H,29,34) |
| InChIKey | OKSOYSOOTZWTED-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|