C29H41N5O — CID 20883034
N-[3-(diethylamino)propyl]-1-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide (PubChem CID 20883034) has the molecular formula C29H41N5O and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20883034 |
| Molecular Formula | C29H41N5O |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(c2nc3ccccc3n2Cc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C29H41N5O/c1-5-32(6-2)17-9-16-30-28(35)24-14-18-33(19-15-24)29-31-26-10-7-8-11-27(26)34(29)21-25-20-22(3)12-13-23(25)4/h7-8,10-13,20,24H,5-6,9,14-19,21H2,1-4H3,(H,30,35) |
| InChIKey | VNVOTMURJIFJDL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|