C19H28N4O2 — CID 16669306
1-(1-ethylbenzimidazol-2-yl)-N-(4-hydroxybutyl)piperidine-4-carboxamide (PubChem CID 16669306) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(1-ethylbenzimidazol-2-yl)-N-(4-hydroxybutyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-ethylbenzimidazol-2-yl)-N-(4-hydroxybutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16669306 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-(1-ethylbenzimidazol-2-yl)-N-(4-hydroxybutyl)piperidine-4-carboxamide |
| SMILES | CCn1c(N2CCC(C(=O)NCCCCO)CC2)nc2ccccc21 |
| InChI | InChI=1S/C19H28N4O2/c1-2-23-17-8-4-3-7-16(17)21-19(23)22-12-9-15(10-13-22)18(25)20-11-5-6-14-24/h3-4,7-8,15,24H,2,5-6,9-14H2,1H3,(H,20,25) |
| InChIKey | AOCAYFJQNVGDLB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|