C23H35N5O2 — CID 42880181
1-[1-(2-methoxyethyl)benzimidazol-2-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide (PubChem CID 42880181) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)benzimidazol-2-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(2-methoxyethyl)benzimidazol-2-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42880181 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 1-[1-(2-methoxyethyl)benzimidazol-2-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide |
| SMILES | COCCn1c(N2CCC(C(=O)NCCN3CCCCC3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C23H35N5O2/c1-30-18-17-28-21-8-4-3-7-20(21)25-23(28)27-14-9-19(10-15-27)22(29)24-11-16-26-12-5-2-6-13-26/h3-4,7-8,19H,2,5-6,9-18H2,1H3,(H,24,29) |
| InChIKey | HBZZXFFCYCJIHH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |