C23H34N4O2 — CID 93015049
(3S)-1-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 93015049) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is (3S)-1-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93015049 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (3S)-1-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN(c2nc3ccccc3n2CC2CCCCC2)C1 |
| InChI | InChI=1S/C23H34N4O2/c1-29-15-13-24-22(28)19-10-7-14-26(17-19)23-25-20-11-5-6-12-21(20)27(23)16-18-8-3-2-4-9-18/h5-6,11-12,18-19H,2-4,7-10,13-17H2,1H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | CSCWPXZVKAGZHH-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|