C18H24N4O3 — CID 51494618
methyl 2-[[(3R)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carbonyl]amino]acetate (PubChem CID 51494618) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 2-[[(3R)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(3R)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 51494618 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 2-[[(3R)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carbonyl]amino]acetate |
| SMILES | CCn1c(N2CCC[C@@H](C(=O)NCC(=O)OC)C2)nc2ccccc21 |
| InChI | InChI=1S/C18H24N4O3/c1-3-22-15-9-5-4-8-14(15)20-18(22)21-10-6-7-13(12-21)17(24)19-11-16(23)25-2/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | FVYGTQAJBBZOLS-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |