C19H26N4O2 — CID 43817815
N-(2-ethenoxyethyl)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carboxamide (PubChem CID 43817815) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(2-ethenoxyethyl)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-ethenoxyethyl)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43817815 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(2-ethenoxyethyl)-1-(1-ethylbenzimidazol-2-yl)piperidine-3-carboxamide |
| SMILES | C=COCCNC(=O)C1CCCN(c2nc3ccccc3n2CC)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-23-17-10-6-5-9-16(17)21-19(23)22-12-7-8-15(14-22)18(24)20-11-13-25-4-2/h4-6,9-10,15H,2-3,7-8,11-14H2,1H3,(H,20,24) |
| InChIKey | ACSXYOFBYZYBAR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|