C20H28N4O2 — CID 16675719
N-(3-methoxypropyl)-1-(1-prop-2-enylbenzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 16675719) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-(1-prop-2-enylbenzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-(1-prop-2-enylbenzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16675719 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-(3-methoxypropyl)-1-(1-prop-2-enylbenzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | C=CCn1c(N2CCC(C(=O)NCCCOC)CC2)nc2ccccc21 |
| InChI | InChI=1S/C20H28N4O2/c1-3-12-24-18-8-5-4-7-17(18)22-20(24)23-13-9-16(10-14-23)19(25)21-11-6-15-26-2/h3-5,7-8,16H,1,6,9-15H2,2H3,(H,21,25) |
| InChIKey | QAFSFHZNQSNCFK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|