C20H24N4OS — CID 46959589
1-(1-ethylbenzimidazol-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 46959589) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-(1-ethylbenzimidazol-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 1-(1-ethylbenzimidazol-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46959589 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-(1-ethylbenzimidazol-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCn1c(N2CCCC(C(=O)NCc3cccs3)C2)nc2ccccc21 |
| InChI | InChI=1S/C20H24N4OS/c1-2-24-18-10-4-3-9-17(18)22-20(24)23-11-5-7-15(14-23)19(25)21-13-16-8-6-12-26-16/h3-4,6,8-10,12,15H,2,5,7,11,13-14H2,1H3,(H,21,25) |
| InChIKey | LCEUIVWJIZBELA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |