C26H26N4O2S — CID 30455822
(3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 30455822) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30455822 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (3S)-1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@H]1CCCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)C1 |
| InChI | InChI=1S/C26H26N4O2S/c31-25(27-16-21-11-7-15-33-21)20-10-6-14-29(18-20)24-26(32)30(17-19-8-2-1-3-9-19)23-13-5-4-12-22(23)28-24/h1-5,7-9,11-13,15,20H,6,10,14,16-18H2,(H,27,31)/t20-/m0/s1 |
| InChIKey | KYDJOSLWXFVUAB-FQEVSTJZSA-N |
| XLogP | 4.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |