C28H36FN5O — CID 20886797
1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 20886797) has the molecular formula C28H36FN5O and a molecular weight of 477.63 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20886797 |
| Molecular Formula | C28H36FN5O |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)C1CCN(c2nc3ccccc3n2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H36FN5O/c29-24-11-9-22(10-12-24)21-34-26-8-3-2-7-25(26)31-28(34)33-19-13-23(14-20-33)27(35)30-15-6-18-32-16-4-1-5-17-32/h2-3,7-12,23H,1,4-6,13-21H2,(H,30,35) |
| InChIKey | YDOGVQYLYYGQNR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|