C29H39FN6O — CID 20886844
N-[3-(4-ethylpiperazin-1-yl)propyl]-1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide (PubChem CID 20886844) has the molecular formula C29H39FN6O and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20886844 |
| Molecular Formula | C29H39FN6O |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2CCN(c3nc4ccccc4n3Cc3cccc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C29H39FN6O/c1-2-33-17-19-34(20-18-33)14-6-13-31-28(37)24-11-15-35(16-12-24)29-32-26-9-3-4-10-27(26)36(29)22-23-7-5-8-25(30)21-23/h3-5,7-10,21,24H,2,6,11-20,22H2,1H3,(H,31,37) |
| InChIKey | CGFZTYGGNNFIRA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|