C26H20F6N4O — CID 46261056
1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]-N-(2,3,4,5,6-pentafluorophenyl)piperidine-4-carboxamide (PubChem CID 46261056) has the molecular formula C26H20F6N4O and a molecular weight of 518.46 g/mol. Its IUPAC name is 1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]-N-(2,3,4,5,6-pentafluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]-N-(2,3,4,5,6-pentafluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46261056 |
| Molecular Formula | C26H20F6N4O |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 1-[1-[(3-fluorophenyl)methyl]benzimidazol-2-yl]-N-(2,3,4,5,6-pentafluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)C1CCN(c2nc3ccccc3n2Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C26H20F6N4O/c27-16-5-3-4-14(12-16)13-36-18-7-2-1-6-17(18)33-26(36)35-10-8-15(9-11-35)25(37)34-24-22(31)20(29)19(28)21(30)23(24)32/h1-7,12,15H,8-11,13H2,(H,34,37) |
| InChIKey | DBRHJPITWSPFNZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|