C28H35N5O2 — CID 53062473
1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 53062473) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53062473 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)C1CCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C28H35N5O2/c34-27(29-15-8-18-31-16-6-7-17-31)23-13-19-32(20-14-23)26-28(35)33(21-22-9-2-1-3-10-22)25-12-5-4-11-24(25)30-26/h1-5,9-12,23H,6-8,13-21H2,(H,29,34) |
| InChIKey | JCAHROFEDXEUPX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|