C27H34N6O2 — CID 50781226
1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 50781226) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50781226 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)C1CCN(c2nc3cccnc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C27H34N6O2/c34-26(29-14-7-17-31-15-4-5-16-31)22-11-18-32(19-12-22)25-27(35)33(20-21-8-2-1-3-9-21)24-23(30-25)10-6-13-28-24/h1-3,6,8-10,13,22H,4-5,7,11-12,14-20H2,(H,29,34) |
| InChIKey | ZTQHSRSUORUAEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|