C29H31N5O2 — CID 50781121
1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 50781121) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50781121 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2nc3cccnc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C29H31N5O2/c35-28(31-18-7-13-22-9-3-1-4-10-22)24-15-19-33(20-16-24)27-29(36)34(21-23-11-5-2-6-12-23)26-25(32-27)14-8-17-30-26/h1-6,8-12,14,17,24H,7,13,15-16,18-21H2,(H,31,35) |
| InChIKey | BDYJWCADPBZRJZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|