C27H28N4O3 — CID 53062480
1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide (PubChem CID 53062480) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53062480 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[2-(furan-2-yl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccco1)C1CCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C27H28N4O3/c32-26(28-15-12-22-9-6-18-34-22)21-13-16-30(17-14-21)25-27(33)31(19-20-7-2-1-3-8-20)24-11-5-4-10-23(24)29-25/h1-11,18,21H,12-17,19H2,(H,28,32) |
| InChIKey | BHAORGWQTJQHBU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |