C27H26N4O — CID 121070694
1-[6-(2-methylphenyl)pyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide (PubChem CID 121070694) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[6-(2-methylphenyl)pyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-[6-(2-methylphenyl)pyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 121070694 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[6-(2-methylphenyl)pyridazin-3-yl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(N2CCCC(C(=O)Nc3cccc4ccccc34)C2)nn1 |
| InChI | InChI=1S/C27H26N4O/c1-19-8-2-4-12-22(19)25-15-16-26(30-29-25)31-17-7-11-21(18-31)27(32)28-24-14-6-10-20-9-3-5-13-23(20)24/h2-6,8-10,12-16,21H,7,11,17-18H2,1H3,(H,28,32) |
| InChIKey | UJSGPDZBJUXJMB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |