C22H30N4O — CID 93055658
(3S)-N-(3-methylbutyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 93055658) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (3S)-N-(3-methylbutyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-methylbutyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93055658 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (3S)-N-(3-methylbutyl)-1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(N2CCC[C@H](C(=O)NCCC(C)C)C2)nn1 |
| InChI | InChI=1S/C22H30N4O/c1-16(2)12-13-23-22(27)18-8-6-14-26(15-18)21-11-10-20(24-25-21)19-9-5-4-7-17(19)3/h4-5,7,9-11,16,18H,6,8,12-15H2,1-3H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | JVQUQNJREHSONW-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |