C26H28N4O3 — CID 121070672
ethyl 4-[[1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 121070672) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is ethyl 4-[[1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 121070672 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | ethyl 4-[[1-[6-(2-methylphenyl)pyridazin-3-yl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCCN(c3ccc(-c4ccccc4C)nn3)C2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-33-26(32)19-10-12-21(13-11-19)27-25(31)20-8-6-16-30(17-20)24-15-14-23(28-29-24)22-9-5-4-7-18(22)2/h4-5,7,9-15,20H,3,6,8,16-17H2,1-2H3,(H,27,31) |
| InChIKey | QAIHSWYXJBZSEU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |