C20H24N4OS — CID 46392301
N-cyclopropyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide (PubChem CID 46392301) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is N-cyclopropyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46392301 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-cyclopropyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(Sc2nccnc2N2CCCC(C(=O)NC3CC3)C2)cc1 |
| InChI | InChI=1S/C20H24N4OS/c1-14-4-8-17(9-5-14)26-20-18(21-10-11-22-20)24-12-2-3-15(13-24)19(25)23-16-6-7-16/h4-5,8-11,15-16H,2-3,6-7,12-13H2,1H3,(H,23,25) |
| InChIKey | RBQYZPFWVGRSJS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |