C24H33N5OS — CID 92884265
(3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 92884265) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92884265 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(Sc2nccnc2N2CCC[C@H](C(=O)NCCCN3CCCC3)C2)cc1 |
| InChI | InChI=1S/C24H33N5OS/c1-19-7-9-21(10-8-19)31-24-22(25-12-13-27-24)29-17-4-6-20(18-29)23(30)26-11-5-16-28-14-2-3-15-28/h7-10,12-13,20H,2-6,11,14-18H2,1H3,(H,26,30)/t20-/m0/s1 |
| InChIKey | PMXOUZLZYVHMKU-FQEVSTJZSA-N |
| XLogP | 3.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|