C24H33N5O2S — CID 92884231
(3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide (PubChem CID 92884231) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92884231 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (3S)-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(Sc2nccnc2N2CCC[C@H](C(=O)NCCCN3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C24H33N5O2S/c1-19-5-7-21(8-6-19)32-24-22(25-10-11-27-24)29-13-2-4-20(18-29)23(30)26-9-3-12-28-14-16-31-17-15-28/h5-8,10-11,20H,2-4,9,12-18H2,1H3,(H,26,30)/t20-/m0/s1 |
| InChIKey | KIBGXGPHDSHIGQ-FQEVSTJZSA-N |
| XLogP | 2.99 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|