C22H30N4OS — CID 46392303
1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-pentylpiperidine-3-carboxamide (PubChem CID 46392303) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-pentylpiperidine-3-carboxamide.
| Compound Name | 1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-pentylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46392303 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]-N-pentylpiperidine-3-carboxamide |
| SMILES | CCCCCNC(=O)C1CCCN(c2nccnc2Sc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H30N4OS/c1-3-4-5-12-24-21(27)18-7-6-15-26(16-18)20-22(25-14-13-23-20)28-19-10-8-17(2)9-11-19/h8-11,13-14,18H,3-7,12,15-16H2,1-2H3,(H,24,27) |
| InChIKey | PUAHTNSUJPXTGH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|